ChemNet > CAS > 499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde
499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde
| Ürün Adı |
1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
| ingilizce adı |
1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde; 1-methyl-1H-benzo[d][1,2,3]triazole-5-carbaldehyde; 1-methylbenzotriazole-5-carbaldehyde |
| Moleküler Formülü |
C8H7N3O |
| Molekül Ağırlığı |
161.1607 |
| InChI |
InChI=1/C8H7N3O/c1-11-8-3-2-6(5-12)4-7(8)9-10-11/h2-5H,1H3 |
| CAS kayıt numarası |
499770-67-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.333g/cm3 |
| Ergime noktası |
159℃ |
| Kaynama noktası |
354.124°C at 760 mmHg |
| Kırılma indisi |
1.668 |
| Alevlenme noktası |
167.968°C |
| Buhar basıncı |
0mmHg at 25°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
