ChemNet > CAS > 499785-52-3 ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate
499785-52-3 ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate
| Ürün Adı |
ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate |
| ingilizce adı |
ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate; ethyl 1-methyl-1H-benzo[d][1,2,3]triazole-5-carboxylate; ethyl 1-methylbenzotriazole-5-carboxylate |
| Moleküler Formülü |
C10H11N3O2 |
| Molekül Ağırlığı |
205.2132 |
| InChI |
InChI=1/C10H11N3O2/c1-3-15-10(14)7-4-5-9-8(6-7)11-12-13(9)2/h4-6H,3H2,1-2H3 |
| CAS kayıt numarası |
499785-52-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.292g/cm3 |
| Ergime noktası |
98℃ |
| Kaynama noktası |
356.961°C at 760 mmHg |
| Kırılma indisi |
1.616 |
| Alevlenme noktası |
169.684°C |
| Buhar basıncı |
0mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
