ChemNet > CAS > 519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde
519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde
Ürün Adı |
2-Carboxy-3,4-dimethoxybenzaldehyde |
ingilizce adı |
2-Carboxy-3,4-dimethoxybenzaldehyde; 5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid; 6-formyl-2,3-dimethoxybenzoic acid |
Moleküler Formülü |
C10H10O5 |
Molekül Ağırlığı |
210.1834 |
InChI |
InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
CAS kayıt numarası |
519-05-1 |
EINECS |
208-261-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.3g/cm3 |
Kaynama noktası |
386.3°C at 760 mmHg |
Kırılma indisi |
1.573 |
Alevlenme noktası |
155.1°C |
Buhar basıncı |
1.17E-06mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|