ChemNet > CAS > 5197-28-4 2-Bromo-4-nitroanisole
5197-28-4 2-Bromo-4-nitroanisole
| Ürün Adı |
2-Bromo-4-nitroanisole |
| ingilizce adı |
2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-; 2-bromo-1-methoxy-4-nitrobenzene |
| Moleküler Formülü |
C7H6BrNO3 |
| Molekül Ağırlığı |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| CAS kayıt numarası |
5197-28-4 |
| EINECS |
225-983-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.64g/cm3 |
| Ergime noktası |
104-106℃ |
| Kaynama noktası |
306.3°C at 760 mmHg |
| Kırılma indisi |
1.581 |
| Alevlenme noktası |
139.1°C |
| Buhar basıncı |
0.00141mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
