ChemNet > CAS > 524-95-8 Diphenylborinic acid 2-aminoethyl ester
524-95-8 Diphenylborinic acid 2-aminoethyl ester
| Ürün Adı |
Diphenylborinic acid 2-aminoethyl ester |
| ingilizce adı |
Diphenylborinic acid 2-aminoethyl ester; 2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
| Moleküler Formülü |
C14H16BNO |
| Molekül Ağırlığı |
225.0939 |
| InChI |
InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| CAS kayıt numarası |
524-95-8 |
| EINECS |
208-366-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.04g/cm3 |
| Ergime noktası |
190-194℃ |
| Kaynama noktası |
325.3°C at 760 mmHg |
| Kırılma indisi |
1.559 |
| Alevlenme noktası |
150.6°C |
| Buhar basıncı |
0.000232mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
