ChemNet > CAS > 527-31-1 Hexaketocyclohexane octahydrate
527-31-1 Hexaketocyclohexane octahydrate
| Ürün Adı |
Hexaketocyclohexane octahydrate |
| ingilizce adı |
Hexaketocyclohexane octahydrate; cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
| Moleküler Formülü |
C6H16O14 |
| Molekül Ağırlığı |
312.1828 |
| InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
| CAS kayıt numarası |
527-31-1 |
| EINECS |
208-412-4 |
| Moleküler Yapısı |
|
| Ergime noktası |
90-93℃ |
| Kaynama noktası |
344.7°C at 760 mmHg |
| Alevlenme noktası |
152°C |
| Buhar basıncı |
6.49E-05mmHg at 25°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
