Ürün Adı |
N-(1-Oxododecyl)-L-glutamic acid, compound with 2,2',2''-nitrilotrisethanol (1:1) |
ingilizce adı |
N-(1-Oxododecyl)-L-glutamic acid, compound with 2,2',2''-nitrilotrisethanol (1:1); L-Glutamic acid, N-(1-oxododecyl)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); N-dodecanoyl-L-glutamic acid - 2,2',2''-nitrilotriethanol (1:1); TEA-LAUROYL GLUTAMATE; Triethanolamine lauroyl glutamate; L-Glutamic acid, N-(1-oxododecyl)-, compd. with 2,2',2''-nitrilotris[ethanol]; L-Glutamic acid,N-(1-oxododecyl)-,compd. with 2,2',2''-nitrilotris[ethanol]; Softan LGT-30 |
Moleküler Formülü |
C23H46N2O8 |
Molekül Ağırlığı |
478.6199 |
InChI |
InChI=1/C17H31NO5.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;8-4-1-7(2-5-9)3-6-10/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);8-10H,1-6H2/t14-;/m0./s1 |
CAS kayıt numarası |
53576-49-1;31955-67-6 |
EINECS |
258-636-1 |
Moleküler Yapısı |
|
Kaynama noktası |
543.6°C at 760 mmHg |
Alevlenme noktası |
282.6°C |
Buhar basıncı |
2.95E-13mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|