ChemNet > CAS > 5380-42-7 Thiophene-2-carboxylic acid methy lester
5380-42-7 Thiophene-2-carboxylic acid methy lester
| Ürün Adı |
Thiophene-2-carboxylic acid methy lester |
| ingilizce adı |
Thiophene-2-carboxylic acid methy lester; Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
| Moleküler Formülü |
C6H6O2S |
| Molekül Ağırlığı |
142.1756 |
| InChI |
InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| CAS kayıt numarası |
5380-42-7 |
| EINECS |
226-371-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.217g/cm3 |
| Kaynama noktası |
200.2°C at 760 mmHg |
| Kırılma indisi |
1.535 |
| Alevlenme noktası |
74.9°C |
| Buhar basıncı |
0.329mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
