ChemNet > CAS > 34145-05-6;5402-73-7 2,5-Dichlorobenzyl alcohol
34145-05-6;5402-73-7 2,5-Dichlorobenzyl alcohol
Ürün Adı |
2,5-Dichlorobenzyl alcohol |
ingilizce adı |
2,5-Dichlorobenzyl alcohol; 2,5-Dichlorobenzylic alcohol; (2,5-dichlorophenyl)methanol |
Moleküler Formülü |
C7H6Cl2O |
Molekül Ağırlığı |
177.0279 |
InChI |
InChI=1/C7H6Cl2O/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2 |
CAS kayıt numarası |
34145-05-6;5402-73-7 |
EINECS |
251-850-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.392g/cm3 |
Ergime noktası |
77-80℃ |
Kaynama noktası |
265.7°C at 760 mmHg |
Kırılma indisi |
1.582 |
Alevlenme noktası |
114.3°C |
Buhar basıncı |
0.00452mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|