5445-22-7 Methyl 2-bromooctanoate
Ürün Adı |
Methyl 2-bromooctanoate |
ingilizce adı |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
Moleküler Formülü |
C9H17BrO2 |
Molekül Ağırlığı |
237.1341 |
InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
CAS kayıt numarası |
5445-22-7 |
EINECS |
226-644-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.221g/cm3 |
Kaynama noktası |
227.7°C at 760 mmHg |
Kırılma indisi |
1.46 |
Alevlenme noktası |
101.9°C |
Buhar basıncı |
0.0763mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|