5447-99-4 3-Nitro-2-pentanol
Ürün Adı |
3-Nitro-2-pentanol |
ingilizce adı |
3-Nitro-2-pentanol; 3-Nitro-2-pentanol,mixture of (?-threo and (?-erythro; 3-nitropentan-2-ol; (2R,3S)-3-nitropentan-2-ol; (2R,3R)-3-nitropentan-2-ol; (2S,3S)-3-nitropentan-2-ol; (2S,3R)-3-nitropentan-2-ol |
Moleküler Formülü |
C5H11NO3 |
Molekül Ağırlığı |
133.1457 |
InChI |
InChI=1/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3/t4-,5+/m0/s1 |
CAS kayıt numarası |
5447-99-4 |
EINECS |
226-669-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.09g/cm3 |
Kaynama noktası |
215.8°C at 760 mmHg |
Kırılma indisi |
1.447 |
Alevlenme noktası |
90.6°C |
Buhar basıncı |
0.0314mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|