ChemNet > CAS > 54745-92-5 2-kinoksaloil klorür
54745-92-5 2-kinoksaloil klorür
| Ürün Adı |
2-kinoksaloil klorür |
| Eş anlamlı |
2-Kinoksalinkarbonil klorür; kinoksalin-2-karbonil klorür;
|
| ingilizce adı |
2-quinoxaloyl chloride; 2-Quinoxalinecarbonyl chloride; quinoxaline-2-carbonyl chloride |
| Moleküler Formülü |
C9H5ClN2O |
| Molekül Ağırlığı |
192.6018 |
| InChI |
InChI=1/C9H5ClN2O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-5H |
| CAS kayıt numarası |
54745-92-5 |
| EINECS |
259-315-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.411g/cm3 |
| Ergime noktası |
113℃ |
| Kaynama noktası |
324.4°C at 760 mmHg |
| Kırılma indisi |
1.662 |
| Alevlenme noktası |
150°C |
| Buhar basıncı |
0.000246mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
