ChemNet > CAS > 37887-04-0;54812-86-1 (R*,S*)-3-Mercaptobutan-2-ol
37887-04-0;54812-86-1 (R*,S*)-3-Mercaptobutan-2-ol
| Ürün Adı |
(R*,S*)-3-Mercaptobutan-2-ol |
| ingilizce adı |
(R*,S*)-3-Mercaptobutan-2-ol; 2-Butanol, 3-mercapto-,(2R,3S)-rel-; 2-Butanol,3-mercapto-, (R*,S*)-; 3-Mercapto-2-butanol; 2-Butanol, 3-mercapto-, (theta,S)-; 2-Mercapto-3-Butanol; 3-Mercapto-2-butanol,mixture of isomers; 3-mercapto-2-butanol, mixture of isomers; 3-mercaptobutan-2-ol; 3-Sulfanylbutan-2-ol |
| Moleküler Formülü |
C4H10OS |
| Molekül Ağırlığı |
106.1866 |
| InChI |
InChI=1/C4H10OS/c1-3(5)4(2)6/h3-6H,1-2H3 |
| CAS kayıt numarası |
37887-04-0;54812-86-1 |
| EINECS |
253-701-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.993g/cm3 |
| Kaynama noktası |
162.3°C at 760 mmHg |
| Kırılma indisi |
1.472 |
| Alevlenme noktası |
61.7°C |
| Buhar basıncı |
0.75mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
|
|
