ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
| Ürün Adı |
p-Diethylaminoacetophenone |
| ingilizce adı |
p-Diethylaminoacetophenone; 4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
| Moleküler Formülü |
C12H17NO |
| Molekül Ağırlığı |
191.2695 |
| InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
| CAS kayıt numarası |
5520-66-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.996g/cm3 |
| Kaynama noktası |
313.9°C at 760 mmHg |
| Kırılma indisi |
1.536 |
| Alevlenme noktası |
114.4°C |
| Buhar basıncı |
0.000482mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
