5524-05-0 (+)-Dihydrocarvone
Ürün Adı |
(+)-Dihydrocarvone |
ingilizce adı |
(+)-Dihydrocarvone; (+)-Dihydrocarvone, mixture of isomers; p-Menth-8(9)-en-2-one; 8-p-Menthen-2-one; (2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone; (2S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
Moleküler Formülü |
C10H16O |
Molekül Ağırlığı |
152.2334 |
InChI |
InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
CAS kayıt numarası |
5524-05-0 |
EINECS |
226-872-4 |
Moleküler Yapısı |
|
Yoğunluk |
0.903g/cm3 |
Kaynama noktası |
221.5°C at 760 mmHg |
Kırılma indisi |
1.457 |
Alevlenme noktası |
82.6°C |
Buhar basıncı |
0.107mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|