ChemNet > CAS > 55406-13-8 3-Methylthiophene-2-carbonitrile
55406-13-8 3-Methylthiophene-2-carbonitrile
| Ürün Adı |
3-Methylthiophene-2-carbonitrile |
| ingilizce adı |
3-Methylthiophene-2-carbonitrile; 2-Cyano-3-methylthiophene |
| Moleküler Formülü |
C6H5NS |
| Molekül Ağırlığı |
123.1756 |
| InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
| CAS kayıt numarası |
55406-13-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.16g/cm3 |
| Kaynama noktası |
212.7°C at 760 mmHg |
| Kırılma indisi |
1.556 |
| Alevlenme noktası |
82.4°C |
| Buhar basıncı |
0.171mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
