| Ürün Adı |
3,7-dihidro-1,3-dimetil-1H-pürin-2,6-dion, 1-aminopropan-2-ol (1:1) ile bileşik |
| Eş anlamlı |
Teofilin izopropanolamin; 3,7-Dihidro-1,3-dimetil-1H-pürin-2,6-dion, 1-aminopropan-2-ol (1:1) ile bileşik; 1,3-dimetil-3,7-dihidro-1H-pürin-2,6-dion; 1,3-dimetil-3,7-dihidro-1H-pürin-2,6-dion - 1-aminopropan-2-ol (1:1);
|
| ingilizce adı |
3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1);Theophylline isopropanolamine; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 1-aminopropan-2-ol (1:1) |
| Moleküler Formülü |
C10H17N5O3 |
| Molekül Ağırlığı |
255.2737 |
| InChI |
InChI=1/C7H8N4O2.C3H9NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-3(5)2-4/h3H,1-2H3,(H,8,9);3,5H,2,4H2,1H3 |
| CAS kayıt numarası |
5600-19-1 |
| EINECS |
227-017-8 |
| Moleküler Yapısı |
|
| Kaynama noktası |
454.1°C at 760 mmHg |
| Alevlenme noktası |
228.4°C |
| Buhar basıncı |
1.96E-08mmHg at 25°C |
|