ChemNet > CAS > 5715-23-1 3,4-Dimethylcyclohexanol
5715-23-1 3,4-Dimethylcyclohexanol
Ürün Adı |
3,4-Dimethylcyclohexanol |
ingilizce adı |
3,4-Dimethylcyclohexanol;3,4-Dimethylcyclohexan-1-ol |
Moleküler Formülü |
C8H16O |
Molekül Ağırlığı |
128.212 |
InChI |
InChI=1/C8H16O/c1-6-3-4-8(9)5-7(6)2/h6-9H,3-5H2,1-2H3 |
CAS kayıt numarası |
5715-23-1 |
EINECS |
227-211-2 |
Moleküler Yapısı |
|
Yoğunluk |
0.893g/cm3 |
Kaynama noktası |
189°C at 760 mmHg |
Kırılma indisi |
1.451 |
Alevlenme noktası |
78.3°C |
Buhar basıncı |
0.16mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|