ChemNet > CAS > 57238-76-3 5- (Klorometil) -3- (4-metoksifenil) - 1,2,4-oksadiazol
57238-76-3 5- (Klorometil) -3- (4-metoksifenil) - 1,2,4-oksadiazol
| Ürün Adı |
5- (Klorometil) -3- (4-metoksifenil) - 1,2,4-oksadiazol |
| Eş anlamlı |
5- (klorometil) -3- (4-metoksifenil) -1,2,4-oksadiazol;
|
| ingilizce adı |
5-(Chloromethyl)-3-(4-methoxyphenyl)- 1,2,4-oxadiazole;5-(chloromethyl)-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| Moleküler Formülü |
C10H9ClN2O2 |
| Molekül Ağırlığı |
224.6437 |
| InChI |
InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-12-9(6-11)15-13-10/h2-5H,6H2,1H3 |
| CAS kayıt numarası |
57238-76-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.278g/cm3 |
| Ergime noktası |
51℃ |
| Kaynama noktası |
354.9°C at 760 mmHg |
| Kırılma indisi |
1.547 |
| Alevlenme noktası |
168.4°C |
| Buhar basıncı |
6.63E-05mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|