Ürün Adı |
teofilin - 2-aminoetanol |
Eş anlamlı |
Teofilin olamin; Teofilin etanolamin; Krizatan; Etanol, 2-amino-, compd.teofilin ile (1:1); Filo-teofilin; Monoteamin; Monoteamin; Monoxantil; Tiyatro; 2-aminoetanol (1:1) içeren teofilin bileşiği; Teofilin monoetanolamin; Teopilin monoetanolamin; Unofilin; 1H-Pürin-2,6-dion, 3,7-dihidro-1,3-dimetil-, compd.2-aminoetanol (1:1) ile; Teofilin 2-aminoetanol; Teofilin, 2-aminoetanol (1: 1) ile birlikte; 1,3-dimetil-3,7-dihidro-1H-pürin-2,6-dion - 2-aminoetanol (1:1);
|
ingilizce adı |
theophylline--2-aminoethanol;Theophylline olamine; Theophylline ethanolamine; Clysmathane; Ethanol, 2-amino-, compd. with theophylline (1:1); Fleet-theophylline; Monotheamin; Monotheamine; Monoxantil; Theamin; Theophylline compound with 2-aminoethanol (1:1); Theophylline monoethanolamine; Theopylline monoethanolamine; Unophyllin; 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-, compd. with 2-aminoethanol (1:1); Theophylline 2-aminoethanol; Theophylline, compd. with 2-aminoethanol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-aminoethanol (1:1) |
Moleküler Formülü |
C9H15N5O3 |
Molekül Ağırlığı |
241.2471 |
InChI |
InChI=1/C7H8N4O2.C2H7NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h3H,1-2H3,(H,8,9);4H,1-3H2 |
CAS kayıt numarası |
573-41-1 |
EINECS |
209-355-8 |
Moleküler Yapısı |
|
Kaynama noktası |
454.1°C at 760 mmHg |
Alevlenme noktası |
228.4°C |
Buhar basıncı |
1.96E-08mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|