ChemNet > CAS > 57915-78-3 2,3-dichlorobenzyl bromide
57915-78-3 2,3-dichlorobenzyl bromide
Ürün Adı |
2,3-dichlorobenzyl bromide |
ingilizce adı |
2,3-dichlorobenzyl bromide;1-(bromomethyl)-2,3-dichlorobenzene |
Moleküler Formülü |
C7H5BrCl2 |
Molekül Ağırlığı |
239.9246 |
InChI |
InChI=1/C7H5BrCl2/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
CAS kayıt numarası |
57915-78-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.679g/cm3 |
Ergime noktası |
38℃ |
Kaynama noktası |
263.3°C at 760 mmHg |
Kırılma indisi |
1.597 |
Alevlenme noktası |
127.3°C |
Buhar basıncı |
0.0169mmHg at 25°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|