ChemNet > CAS > 57981-02-9 O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride
57981-02-9 O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride
Ürün Adı |
O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride |
ingilizce adı |
O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride; O-(2,3,4,5,6-pentafluorobenzyl)*hydroxylamine hyd; O-(pentafluorobenzyl)hydroxylamine; [(pentafluorobenzyl)oxy]ammonium chloride |
Moleküler Formülü |
C7H5ClF5NO |
Molekül Ağırlığı |
249.5657 |
InChI |
InChI=1/C7H5F5NO.ClH/c8-3-2(1-14-13)4(9)6(11)7(12)5(3)10;/h1H2,13H3;1H/q+1;/p-1 |
CAS kayıt numarası |
57981-02-9 |
EINECS |
261-057-7 |
Moleküler Yapısı |
|
Ergime noktası |
227℃ |
Kaynama noktası |
214.5°C at 760 mmHg |
Alevlenme noktası |
83.5°C |
Buhar basıncı |
0.155mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|