ChemNet > CAS > 59463-56-8 siyanometil ethanetiyoat
59463-56-8 siyanometil ethanetiyoat
Ürün Adı |
siyanometil ethanetiyoat |
Eş anlamlı |
S- (siyanometil) etanetiyoat;
|
ingilizce adı |
cyanomethyl ethanethioate;S-(cyanomethyl) ethanethioate |
Moleküler Formülü |
C4H5NOS |
Molekül Ağırlığı |
115.1536 |
InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
CAS kayıt numarası |
59463-56-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.162g/cm3 |
Kaynama noktası |
198.1°C at 760 mmHg |
Kırılma indisi |
1.487 |
Alevlenme noktası |
73.6°C |
Buhar basıncı |
0.367mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|