612-23-7 2-Nitrobenzyl chloride
Ürün Adı |
2-Nitrobenzyl chloride |
ingilizce adı |
2-Nitrobenzyl chloride; alpha-Chloro-2-nitrotoluene; a-Chloro-2-nitrotoluene); 1-chloro-2-methyl-3-nitrobenzene; 1-(chloromethyl)-2-nitrobenzene |
Moleküler Formülü |
C7H6ClNO2 |
Molekül Ağırlığı |
171.581 |
InChI |
InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
CAS kayıt numarası |
612-23-7 |
EINECS |
210-300-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.33g/cm3 |
Ergime noktası |
46-50℃ |
Kaynama noktası |
269°C at 760 mmHg |
Kırılma indisi |
1.574 |
Alevlenme noktası |
112.7°C |
Buhar basıncı |
0.0123mmHg at 25°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|