618-32-6 Benzoyl bromide
Ürün Adı |
Benzoyl bromide |
ingilizce adı |
Benzoyl bromide; |
Moleküler Formülü |
C7H5BrO |
Molekül Ağırlığı |
185.018 |
InChI |
InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
CAS kayıt numarası |
618-32-6 |
EINECS |
210-544-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.572g/cm3 |
Ergime noktası |
-24℃ |
Kaynama noktası |
218.5°C at 760 mmHg |
Kırılma indisi |
1.584 |
Alevlenme noktası |
89.7°C |
Buhar basıncı |
0.125mmHg at 25°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S25:Avoid contact with eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|