ChemNet > CAS > 6326-44-9 Diethyl formamidomalonate
6326-44-9 Diethyl formamidomalonate
| Ürün Adı |
Diethyl formamidomalonate |
| ingilizce adı |
Diethyl formamidomalonate; Formamidomalonic acid diethyl ester; diethyl (formylamino)propanedioate; Diethylformamidomalonate |
| Moleküler Formülü |
C8H13NO5 |
| Molekül Ağırlığı |
203.1925 |
| InChI |
InChI=1/C8H13NO5/c1-3-13-7(11)6(9-5-10)8(12)14-4-2/h5-6H,3-4H2,1-2H3,(H,9,10) |
| CAS kayıt numarası |
6326-44-9 |
| EINECS |
228-692-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.167g/cm3 |
| Ergime noktası |
51-56℃ |
| Kaynama noktası |
316.8°C at 760 mmHg |
| Kırılma indisi |
1.445 |
| Alevlenme noktası |
165.7°C |
| Buhar basıncı |
0.0004mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
