644-78-0 2-Hydroxychalcone
Ürün Adı |
2-Hydroxychalcone |
ingilizce adı |
2-Hydroxychalcone; 2-Hydroxychalcone, [(2-Hydroxybenzylidene)- acetopheno; (2-Hydroxybenzylidene)acetophenone~3-(2-Hydroxyphenyl)-1-phenyl-2-propen-1-one; 3-(2-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(2-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2Z)-1-(2-hydroxyphenyl)-3-phenylprop-2-en-1-one |
Moleküler Formülü |
C15H12O2 |
Molekül Ağırlığı |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-11,16H/b11-10- |
CAS kayıt numarası |
644-78-0 |
EINECS |
211-422-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.191g/cm3 |
Kaynama noktası |
396.566°C at 760 mmHg |
Kırılma indisi |
1.654 |
Alevlenme noktası |
169.35°C |
Buhar basıncı |
0mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|