ChemNet > CAS > 652-40-4 3,6-difluorophthalic anhydride
652-40-4 3,6-difluorophthalic anhydride
| Ürün Adı |
3,6-difluorophthalic anhydride |
| ingilizce adı |
3,6-difluorophthalic anhydride;1,1'-(1,1,1,3,3,3-hexafluoropropane-2,2-diyl)bis(3,4-dimethylbenzene); 4,7-difluoro-2-benzofuran-1,3-dione |
| Moleküler Formülü |
C8H2F2O3 |
| Molekül Ağırlığı |
184.0965 |
| InChI |
InChI=1/C8H2F2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H |
| CAS kayıt numarası |
652-40-4 |
| EINECS |
265-687-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.658g/cm3 |
| Ergime noktası |
218-221℃ |
| Kaynama noktası |
315.7°C at 760 mmHg |
| Kırılma indisi |
1.555 |
| Alevlenme noktası |
140.1°C |
| Buhar basıncı |
0.000429mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
