ChemNet > CAS > 13078-15-4;65369-76-8 Chlorophenylpiperazinehydrochloride
13078-15-4;65369-76-8 Chlorophenylpiperazinehydrochloride
| Ürün Adı |
Chlorophenylpiperazinehydrochloride |
| ingilizce adı |
Chlorophenylpiperazinehydrochloride; 1-(3-Chlorophenyl)piperazine monohydrochloride; 1-(3-chlorophenyl)piperazine hydrochloride; Piperazine, 1-(3-chlorophenyl)-, monohydrochloride; 1-(3-chlorophenyl)piperazine monohcl; 1-(3-chlorophenyl)piperazine hydrochloride (1:1); 1-(m-Chlorophenyl)piperazine hydrochloride |
| Moleküler Formülü |
C10H14Cl2N2 |
| Molekül Ağırlığı |
233.1376 |
| InChI |
InChI=1/C10H13ClN2.ClH/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13;/h1-3,8,12H,4-7H2;1H |
| CAS kayıt numarası |
13078-15-4;65369-76-8 |
| EINECS |
235-976-9 |
| Moleküler Yapısı |
|
| Kaynama noktası |
336.4°C at 760 mmHg |
| Alevlenme noktası |
157.2°C |
| Buhar basıncı |
0.000112mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
