ChemNet > CAS > 6548-09-0 5-Bromo-DL-tryptophan
6548-09-0 5-Bromo-DL-tryptophan
| Ürün Adı |
5-Bromo-DL-tryptophan |
| ingilizce adı |
5-Bromo-DL-tryptophan; 2-Amino-3-(5-bromo-1H-indol-3-yl)propanoic acid; 5-bromotryptophan |
| Moleküler Formülü |
C11H11BrN2O2 |
| Molekül Ağırlığı |
283.1212 |
| InChI |
InChI=1/C11H11BrN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
| CAS kayıt numarası |
6548-09-0 |
| EINECS |
229-464-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.704g/cm3 |
| Ergime noktası |
264-267℃ |
| Kaynama noktası |
495.8°C at 760 mmHg |
| Kırılma indisi |
1.718 |
| Alevlenme noktası |
253.7°C |
| Buhar basıncı |
1.19E-10mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
