ChemNet > CAS > 656-46-2 2,2-Difluoro-1,3-benzodioxole-5-carboxylic acid
656-46-2 2,2-Difluoro-1,3-benzodioxole-5-carboxylic acid
| Ürün Adı |
2,2-Difluoro-1,3-benzodioxole-5-carboxylic acid |
| ingilizce adı |
2,2-Difluoro-1,3-benzodioxole-5-carboxylic acid; 2,2-difluoro-1,3-benzodioxole-5-carboxylate; 2,2-difluorobenzo[d][1,3]dioxole-5-carboxylic acid; 2,2-difluorobenzodioxole-5-carboxylic acid |
| Moleküler Formülü |
C8H3F2O4 |
| Molekül Ağırlığı |
201.1044 |
| InChI |
InChI=1/C8H4F2O4/c9-8(10)13-5-2-1-4(7(11)12)3-6(5)14-8/h1-3H,(H,11,12)/p-1 |
| CAS kayıt numarası |
656-46-2 |
| Moleküler Yapısı |
|
| Kaynama noktası |
266.1°C at 760 mmHg |
| Alevlenme noktası |
114.7°C |
| Buhar basıncı |
0.0044mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
