ChemNet > CAS > 6590-95-0 2,6-Dichlorophenyl isothiocyanate
6590-95-0 2,6-Dichlorophenyl isothiocyanate
| Ürün Adı |
2,6-Dichlorophenyl isothiocyanate |
| ingilizce adı |
2,6-Dichlorophenyl isothiocyanate; 2,6-Dichloroisothiocyanatobenzene; 1,3-dichloro-2-isothiocyanatobenzene; 2,6-Dichloro Phenyl Isothiocynate |
| Moleküler Formülü |
C7H3Cl2NS |
| Molekül Ağırlığı |
204.0764 |
| InChI |
InChI=1/C7H3Cl2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| CAS kayıt numarası |
6590-95-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.37g/cm3 |
| Kaynama noktası |
302.2°C at 760 mmHg |
| Kırılma indisi |
1.614 |
| Alevlenme noktası |
136.5°C |
| Buhar basıncı |
0.00181mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
