ChemNet > CAS > 6950-92-1 2,4,6-Trimethylphenethylalcohol
6950-92-1 2,4,6-Trimethylphenethylalcohol
| Ürün Adı |
2,4,6-Trimethylphenethylalcohol |
| ingilizce adı |
2,4,6-Trimethylphenethylalcohol; 2-Mesitylethanol; 2-Hydroxyethylmesitylene~2,4,6-Trimethylphenethyl alcohol~2-(2,4,6-Trimethylphenyl)ethanol; 2-(2,4,6-trimethylphenyl)ethanol |
| Moleküler Formülü |
C11H16O |
| Molekül Ağırlığı |
164.2441 |
| InChI |
InChI=1/C11H16O/c1-8-6-9(2)11(4-5-12)10(3)7-8/h6-7,12H,4-5H2,1-3H3 |
| CAS kayıt numarası |
6950-92-1 |
| EINECS |
230-123-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.974g/cm3 |
| Kaynama noktası |
290.7°C at 760 mmHg |
| Kırılma indisi |
1.526 |
| Alevlenme noktası |
138.4°C |
| Buhar basıncı |
0.000939mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
