ChemNet > CAS > 701-70-2 Alpha-Ethylphenethyl alcohol
701-70-2 Alpha-Ethylphenethyl alcohol
Ürün Adı |
Alpha-Ethylphenethyl alcohol |
ingilizce adı |
Alpha-Ethylphenethyl alcohol; 1-Phenyl-2-butanol; 1-phenylbutan-2-ol; (2S)-1-phenylbutan-2-ol; (2R)-1-phenylbutan-2-ol |
Moleküler Formülü |
C10H14O |
Molekül Ağırlığı |
150.2176 |
InChI |
InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
CAS kayıt numarası |
701-70-2 |
EINECS |
211-858-2 |
Moleküler Yapısı |
|
Yoğunluk |
0.98g/cm3 |
Kaynama noktası |
226.6°C at 760 mmHg |
Kırılma indisi |
1.52 |
Alevlenme noktası |
100°C |
Buhar basıncı |
0.0459mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|