ChemNet > CAS > 702-23-8 4-Methoxyphenethyl alcohol
702-23-8 4-Methoxyphenethyl alcohol
Ürün Adı |
4-Methoxyphenethyl alcohol |
ingilizce adı |
4-Methoxyphenethyl alcohol; p-Methoxyphenethyl alcohol; 2-(4-Methoxyphenyl)ethanol; p-Methoxyphenylethanol |
Moleküler Formülü |
C9H12O2 |
Molekül Ağırlığı |
152.1904 |
InChI |
InChI=1/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS kayıt numarası |
702-23-8 |
EINECS |
211-866-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.058g/cm3 |
Ergime noktası |
28℃ |
Kaynama noktası |
257.5°C at 760 mmHg |
Kırılma indisi |
1.524 |
Alevlenme noktası |
110.2°C |
Buhar basıncı |
0.00745mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|