ChemNet > CAS > 703-23-1 2-Hydroxy-6-methoxyacetophenone
703-23-1 2-Hydroxy-6-methoxyacetophenone
Ürün Adı |
2-Hydroxy-6-methoxyacetophenone |
ingilizce adı |
2-Hydroxy-6-methoxyacetophenone; 1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone; 2'-Hydroxy-6'-methoxyacetophenone |
Moleküler Formülü |
C9H10O3 |
Molekül Ağırlığı |
166.1739 |
InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
CAS kayıt numarası |
703-23-1 |
EINECS |
211-872-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.158g/cm3 |
Ergime noktası |
58-60℃ |
Kaynama noktası |
259.5°C at 760 mmHg |
Kırılma indisi |
1.537 |
Alevlenme noktası |
108.1°C |
Buhar basıncı |
0.00798mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|