ChemNet > CAS > 713-52-0 Methyl 3-hydroxy-4-nitrobenzoate
713-52-0 Methyl 3-hydroxy-4-nitrobenzoate
| Ürün Adı |
Methyl 3-hydroxy-4-nitrobenzoate |
| ingilizce adı |
Methyl 3-hydroxy-4-nitrobenzoate; 3-Hydroxy-4-nitrobenzoic acid methyl ester; 5-(methoxycarbonyl)-2-nitrophenolate |
| Moleküler Formülü |
C8H6NO5 |
| Molekül Ağırlığı |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-8(11)5-2-3-6(9(12)13)7(10)4-5/h2-4,10H,1H3/p-1 |
| CAS kayıt numarası |
713-52-0 |
| Moleküler Yapısı |
|
| Kaynama noktası |
346.4°C at 760 mmHg |
| Alevlenme noktası |
163.3°C |
| Buhar basıncı |
2.88E-05mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
