ChemNet > CAS > 716-53-0 9-chloroanthracene
716-53-0 9-chloroanthracene
| Ürün Adı |
9-chloroanthracene |
| ingilizce adı |
9-chloroanthracene;Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
| Moleküler Formülü |
C14H9Cl |
| Molekül Ağırlığı |
212.6743 |
| InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| CAS kayıt numarası |
716-53-0 |
| EINECS |
211-937-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.253g/cm3 |
| Ergime noktası |
103-103℃ |
| Kaynama noktası |
370.1°C at 760 mmHg |
| Kırılma indisi |
1.717 |
| Alevlenme noktası |
179.2°C |
| Buhar basıncı |
2.42E-05mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
