716-53-0 9-chloroanthracene
Ürün Adı |
9-chloroanthracene |
ingilizce adı |
9-chloroanthracene;Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
Moleküler Formülü |
C14H9Cl |
Molekül Ağırlığı |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
CAS kayıt numarası |
716-53-0 |
EINECS |
211-937-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.253g/cm3 |
Ergime noktası |
103-103℃ |
Kaynama noktası |
370.1°C at 760 mmHg |
Kırılma indisi |
1.717 |
Alevlenme noktası |
179.2°C |
Buhar basıncı |
2.42E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|