ChemNet > CAS > 71735-21-2 (2,4-Dichloro-5-methylphenylthio)acetic acid
71735-21-2 (2,4-Dichloro-5-methylphenylthio)acetic acid
| Ürün Adı |
(2,4-Dichloro-5-methylphenylthio)acetic acid |
| ingilizce adı |
(2,4-Dichloro-5-methylphenylthio)acetic acid;((2,4-Dichloro-5-methylphenyl)thio)acetic acid; [(2,4-dichloro-5-methylphenyl)sulfanyl]acetic acid |
| Moleküler Formülü |
C9H8Cl2O2S |
| Molekül Ağırlığı |
251.1296 |
| InChI |
InChI=1/C9H8Cl2O2S/c1-5-2-8(14-4-9(12)13)7(11)3-6(5)10/h2-3H,4H2,1H3,(H,12,13) |
| CAS kayıt numarası |
71735-21-2 |
| EINECS |
275-933-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.47g/cm3 |
| Kaynama noktası |
371.2°C at 760 mmHg |
| Kırılma indisi |
1.623 |
| Alevlenme noktası |
178.3°C |
| Buhar basıncı |
3.64E-06mmHg at 25°C |
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|