75-27-4 Bromodichloromethane
Ürün Adı |
Bromodichloromethane |
ingilizce adı |
Bromodichloromethane; FC-20B1 |
Moleküler Formülü |
CHBrCl2 |
Molekül Ağırlığı |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS kayıt numarası |
75-27-4 |
EINECS |
200-856-7 |
Moleküler Yapısı |
|
Yoğunluk |
2.013g/cm3 |
Ergime noktası |
-55℃ |
Kaynama noktası |
89.7°C at 760 mmHg |
Kırılma indisi |
1.503 |
Alevlenme noktası |
1.3°C |
Buhar basıncı |
65.3mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|