ChemNet > CAS > 758-16-7 N,N-Dimethylthioformamide
758-16-7 N,N-Dimethylthioformamide
| Ürün Adı |
N,N-Dimethylthioformamide |
| ingilizce adı |
N,N-Dimethylthioformamide; NN-Dimethylthioformamide |
| Moleküler Formülü |
C3H7NS |
| Molekül Ağırlığı |
89.1594 |
| InChI |
InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
| CAS kayıt numarası |
758-16-7 |
| EINECS |
212-060-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.985g/cm3 |
| Kaynama noktası |
224.9°C at 760 mmHg |
| Kırılma indisi |
1.511 |
| Alevlenme noktası |
89.8°C |
| Buhar basıncı |
0.089mmHg at 25°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
