76410-58-7 4-Borono-L-fenilalanin
Ürün Adı |
4-Borono-L-fenilalanin |
Eş anlamlı |
4-Boronofenilalanin; 10B-BPA; para-Borono-L-fenilalanin; para-Boronofenilalanin; L-Fenilalanin, 4-borono-; 4- (dihidroksiboranil) fenilalanin; 4- (dihidroksiboranil) -L-fenilalanin;
|
ingilizce adı |
4-Borono-L-phenylalanine;4-Boronophenylalanine; 10B-Bpa; para-Borono-L-phenylalanine; para-Boronophenylalanine; L-Phenylalanine, 4-borono-; 4-(dihydroxyboranyl)phenylalanine; 4-(dihydroxyboranyl)-L-phenylalanine |
Moleküler Formülü |
C9H12BNO4 |
Molekül Ağırlığı |
209.0069 |
InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
CAS kayıt numarası |
76410-58-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.34g/cm3 |
Kaynama noktası |
449.3°C at 760 mmHg |
Kırılma indisi |
1.59 |
Alevlenme noktası |
225.5°C |
Buhar basıncı |
7.39E-09mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|