ChemNet > CAS > 765-87-7 1,2-Cyclohexanedione
765-87-7 1,2-Cyclohexanedione
| Ürün Adı |
1,2-Cyclohexanedione |
| ingilizce adı |
1,2-Cyclohexanedione;1,2-Dioxocyclohexane; 4-07-00-01982 (Beilstein Handbook Reference); AI3-25042; BRN 0507419; CCRIS 6296; NSC 32950; cyclohexane-1,2-dione |
| Moleküler Formülü |
C12H18O3 |
| Molekül Ağırlığı |
210.2695 |
| InChI |
InChI=1/C12H18O3/c1-3-7-11-9(5-1)13-12(15-11)8-4-2-6-10(12)14-11/h9-10H,1-8H2 |
| CAS kayıt numarası |
765-87-7 |
| EINECS |
212-155-3 |
| Moleküler Yapısı |
|
| Ergime noktası |
35-38℃ |
| Kırılma indisi |
1.546 |
| Suda çözünürlük |
soluble |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R22:;
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
