ChemNet > CAS > 765-87-7 1,2-Cyclohexanedione
765-87-7 1,2-Cyclohexanedione
Ürün Adı |
1,2-Cyclohexanedione |
ingilizce adı |
1,2-Cyclohexanedione;1,2-Dioxocyclohexane; 4-07-00-01982 (Beilstein Handbook Reference); AI3-25042; BRN 0507419; CCRIS 6296; NSC 32950; cyclohexane-1,2-dione |
Moleküler Formülü |
C12H18O3 |
Molekül Ağırlığı |
210.2695 |
InChI |
InChI=1/C12H18O3/c1-3-7-11-9(5-1)13-12(15-11)8-4-2-6-10(12)14-11/h9-10H,1-8H2 |
CAS kayıt numarası |
765-87-7 |
EINECS |
212-155-3 |
Moleküler Yapısı |
|
Ergime noktası |
35-38℃ |
Kırılma indisi |
1.546 |
Suda çözünürlük |
soluble |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R22:;
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|