ChemNet > CAS > 769-40-4 2,3,5,6-tetrafluorothiophenol
769-40-4 2,3,5,6-tetrafluorothiophenol
| Ürün Adı |
2,3,5,6-tetrafluorothiophenol |
| ingilizce adı |
2,3,5,6-tetrafluorothiophenol; 2,3,5,6-Tetrafluorobenzenethiol; 2,3,5,6-tetrafluorobenzenethiolate |
| Moleküler Formülü |
C6HF4S |
| Molekül Ağırlığı |
181.1313 |
| InChI |
InChI=1/C6H2F4S/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H/p-1 |
| CAS kayıt numarası |
769-40-4 |
| EINECS |
212-210-1 |
| Moleküler Yapısı |
|
| Kaynama noktası |
152.6°C at 760 mmHg |
| Alevlenme noktası |
48.3°C |
| Buhar basıncı |
4.45mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
