ChemNet > CAS > 77-62-3 Methylenebismethylcyclohexylpcresol; 90%
77-62-3 Methylenebismethylcyclohexylpcresol; 90%
Ürün Adı |
Methylenebismethylcyclohexylpcresol; 90% |
ingilizce adı |
Methylenebismethylcyclohexylpcresol; 90%; Bis[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methane; 2,2-methylenebis(6-cyclohexyl-4-methylphenol); 2,2-Methylenebis[6-(1-methylcyclohexyl)-p-cresol]; 2,2'-methanediylbis[4-methyl-6-(1-methylcyclohexyl)phenol] |
Moleküler Formülü |
C29H40O2 |
Molekül Ağırlığı |
420.6267 |
InChI |
InChI=1/C29H40O2/c1-20-15-22(26(30)24(17-20)28(3)11-7-5-8-12-28)19-23-16-21(2)18-25(27(23)31)29(4)13-9-6-10-14-29/h15-18,30-31H,5-14,19H2,1-4H3 |
CAS kayıt numarası |
77-62-3 |
EINECS |
201-044-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.058g/cm3 |
Kaynama noktası |
526.9°C at 760 mmHg |
Kırılma indisi |
1.567 |
Alevlenme noktası |
219.2°C |
Buhar basıncı |
1.02E-11mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|