771-97-1 2,3-Diaminonaphthalene
Ürün Adı |
2,3-Diaminonaphthalene |
ingilizce adı |
2,3-Diaminonaphthalene; 2,3-Naphthalenediamine; naphthalene-2,3-diamine |
Moleküler Formülü |
C10H10N2 |
Molekül Ağırlığı |
158.1998 |
InChI |
InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
CAS kayıt numarası |
771-97-1 |
EINECS |
212-241-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.234g/cm3 |
Ergime noktası |
193-199℃ |
Kaynama noktası |
370.6°C at 760 mmHg |
Kırılma indisi |
1.757 |
Alevlenme noktası |
212.3°C |
Buhar basıncı |
1.1E-05mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|