ChemNet > CAS > 7730-20-3 6-Fluoro-DL-tryptophan
7730-20-3 6-Fluoro-DL-tryptophan
| Ürün Adı |
6-Fluoro-DL-tryptophan |
| ingilizce adı |
6-Fluoro-DL-tryptophan; 6-Fluoro-DL-tryptophane; 2-Amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid; 6-fluoro-L-tryptophan; 6-fluoro-D-tryptophan |
| Moleküler Formülü |
C11H11FN2O2 |
| Molekül Ağırlığı |
222.2156 |
| InChI |
InChI=1/C11H11FN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
| CAS kayıt numarası |
7730-20-3 |
| EINECS |
231-788-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.442g/cm3 |
| Ergime noktası |
280-28500℃ |
| Kaynama noktası |
450.7°C at 760 mmHg |
| Kırılma indisi |
1.673 |
| Alevlenme noktası |
226.4°C |
| Buhar basıncı |
6.54E-09mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
