ChemNet > CAS > 78686-87-0 2,5-dikloropiridin-3-karbonil klorür
78686-87-0 2,5-dikloropiridin-3-karbonil klorür
| Ürün Adı |
2,5-dikloropiridin-3-karbonil klorür |
| Eş anlamlı |
|
| ingilizce adı |
2,5-dichloropyridine-3-carbonyl chloride; |
| Moleküler Formülü |
C6H2Cl3NO |
| Molekül Ağırlığı |
210.4452 |
| InChI |
InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
| CAS kayıt numarası |
78686-87-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.582g/cm3 |
| Kaynama noktası |
269°C at 760 mmHg |
| Kırılma indisi |
1.582 |
| Alevlenme noktası |
116.5°C |
| Buhar basıncı |
0.00745mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
