ChemNet > CAS > 80166-90-1 5-Bromo-7-nitroindoline
80166-90-1 5-Bromo-7-nitroindoline
| Ürün Adı |
5-Bromo-7-nitroindoline |
| ingilizce adı |
5-Bromo-7-nitroindoline; 5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
| Moleküler Formülü |
C8H7BrN2O2 |
| Molekül Ağırlığı |
243.0574 |
| InChI |
InChI=1/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
| CAS kayıt numarası |
80166-90-1 |
| EINECS |
279-411-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.704g/cm3 |
| Kaynama noktası |
344.2°C at 760 mmHg |
| Kırılma indisi |
1.64 |
| Alevlenme noktası |
162°C |
| Buhar basıncı |
6.67E-05mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
