ChemNet > CAS > 8063-24-9 Acriflavine hydrochloride
8063-24-9 Acriflavine hydrochloride
| Ürün Adı |
Acriflavine hydrochloride |
| ingilizce adı |
Acriflavine hydrochloride; Acriflavine HCl; 3,6-diamino-10-methylacridinium chloride - acridine-3,6-diamine hydrochloride (1:1:1:2); 3,6-diamino-10-methylacridinium chloride - acridine-3,6-diamine (1:1) hydrochloride |
| Moleküler Formülü |
C27H26Cl2N6 |
| Molekül Ağırlığı |
505.4415 |
| InChI |
InChI=1/C14H13N3.C13H11N3.2ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;;/h2-8H,1H3,(H3,15,16);1-7H,14-15H2;2*1H |
| CAS kayıt numarası |
8063-24-9 |
| Moleküler Yapısı |
|
| Ergime noktası |
260℃ |
| Tehlike Sembolleri |
 T:Toxic;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R45:May cause cancer.;
R46:May cause heritable genetic damages.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
